The suitable method that can be used for separation of products \(X\) and \(Y\) is: \[ {C6H6 →[CH3Cl/Anhyd. AlCl3] X →[dil. HNO3/H2SO4] X + Y} \]
Match List-I with List-II.
In the following reaction sequence, \(X\) and \(Z\), respectively, are: \[ {CH3CH2CH2OH →[PCl5] CH3CH2CH2Cl + X + HCl} \] \[ {CH3CH2CH2Cl →[alc.\ KOH][\Delta] Y →[HBr] Z} \]
The following two reactions give the same foul smelling product \(Z\):
\[ {C2H5CONH2 →[Br2/NaOH] X} \] \[ {X →[CHCl3/alcoholic\ KOH][\Delta] Z} \] \(X\) and \(Z\), respectively, are:
The correct IUPAC name of the following compound is: \[ {CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH2-CH3} \]
Match List-I with List-II. List-I contains quantum numbers and List-II contains orbitals.
एक बल्ब 150 watt निर्धारित है और यह 8% ऊर्जा प्रकाश में परिवर्तित करता है। यदि एक फ़ोटॉन की ऊर्जा \( 4.42 \times 10^{-19} \) J हो, तो बल्ब से प्रति सेकंड कितने फ़ोटॉन उत्सर्जित होते हैं?
निम्नलिखित दो अभिक्रियाएँ एक ही दुर्गंधयुक्त उत्पाद Z देती हैं। Reaction 1: C\(_2\)H\(_5\)Cl \(\xrightarrow{X}\) Z Reaction 2: C\(_2\)H\(_5\)NH\(_2\) \(\xrightarrow{Br_2, NaOH}\) Y \(\xrightarrow{CHCl_3/\text{एथेनॉली } KOH, \Delta}\) Z X और Z, क्रमशः हैं:
नीचे दिए गए अर्ध सेल का वि.वा. बल (emf) परिकलित कीजिए: