In a test tube containing a salt, a few drops of dilute \({H2SO4}\) was added, which gave colourless vapours having the smell of vinegar. The vapours turned blue litmus paper red. Identify the correct anion from the following.
The suitable method that can be used for separation of products \(X\) and \(Y\) is: \[ {C6H6 →[CH3Cl/Anhyd. AlCl3] X →[dil. HNO3/H2SO4] X + Y} \]
Match List-I with List-II.
In the following reaction sequence, \(X\) and \(Z\), respectively, are: \[ {CH3CH2CH2OH →[PCl5] CH3CH2CH2Cl + X + HCl} \] \[ {CH3CH2CH2Cl →[alc.\ KOH][\Delta] Y →[HBr] Z} \]
The following two reactions give the same foul smelling product \(Z\):
\[ {C2H5CONH2 →[Br2/NaOH] X} \] \[ {X →[CHCl3/alcoholic\ KOH][\Delta] Z} \] \(X\) and \(Z\), respectively, are:
The correct IUPAC name of the following compound is: \[ {CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH2-CH3} \]