Match List-I with List-II.
In the following reaction sequence, \(X\) and \(Z\), respectively, are: \[ {CH3CH2CH2OH →[PCl5] CH3CH2CH2Cl + X + HCl} \] \[ {CH3CH2CH2Cl →[alc.\ KOH][\Delta] Y →[HBr] Z} \]
The following two reactions give the same foul smelling product \(Z\):
\[ {C2H5CONH2 →[Br2/NaOH] X} \] \[ {X →[CHCl3/alcoholic\ KOH][\Delta] Z} \] \(X\) and \(Z\), respectively, are:
The correct IUPAC name of the following compound is: \[ {CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH2-CH3} \]
Match List-I with List-II. List-I contains quantum numbers and List-II contains orbitals.