What is the major product in the following reaction?
CH3-CH2-CH2-CH=CH2+HBr\(\to\)
CH3-CH2-CH2-CH2-CH2-Br
CH3-CH2-CH2-CH2-CH3
Reaction Mechanism: Electrophilic Addition
Markovnikov's Rule
In the addition of HX (where X is a halogen) to an alkene, the hydrogen adds to the carbon with more hydrogens already attached (the less substituted carbon), and the halogen adds to the carbon with fewer hydrogens attached (the more substituted carbon). This rule is also stated as hydrogen will add to the carbon which will produce the most stable (most substituted) carbocation.
Applying Markovnikov's Rule to the Given Reaction
In the given reaction:
CH3-CH2-CH2-CH=CH2 + HBr
The double bond is between carbons 4 and 5 (numbering from the left).
Carbon 4 (CH=) has one hydrogen attached.
Carbon 5 (=CH2) has two hydrogens attached.
According to Markovnikov's rule, the hydrogen from HBr will add to carbon 5 (the carbon with more hydrogens), and the bromine will add to carbon 4 (the carbon with fewer hydrogens). This gives the following major product:
CH3-CH2-CH2-CHBr-CH3
Therefore, the correct answer is (B) CH3-CH2-CH2-CHBr-CH3
1. Reaction analysis:
The given reaction involves the addition of hydrogen bromide (\( \text{HBr} \)) to 1-pentene (\( \text{CH}_3\text{CH}_2\text{CH}_2\text{CH}=\text{CH}_2 \)). This is an example of an electrophilic addition reaction, where \( \text{HBr} \) adds across the double bond. The major product depends on the regioselectivity of the reaction, which is governed by Markovnikov's rule.
2. Apply Markovnikov's Rule:
3. Write the major product:
4. Match the product with the given options:
Which are the non-benzenoid aromatic compounds in the following?

| a) | Alkane | (i) | Phenol |
| b) | Alicyclic compound | (ii) | Tropolone |
| c) | Benzenoid aromatic compound | (iii) | Isobutane |
| d) | Non-benzenoid aromatic compound | (iv) | Furan |
| e) | Heterocyclic compound | (v) | Cyclohexene |
If $ | \vec{a} | = 3 $, $ | \vec{b} | = 2 $, then find $ (3\vec{a} - 2\vec{b}) \cdot (3\vec{a} + 2\vec{b}) $.
In organic chemistry, an alkene is a hydrocarbon containing a carbon-carbon double bond.[1]
Alkene is often used as synonym of olefin, that is, any hydrocarbon containing one or more double bonds.
Read More: Ozonolysis
Read More: Unsaturated Hydrocarbon