| a) | Alkane | (i) | Phenol |
| b) | Alicyclic compound | (ii) | Tropolone |
| c) | Benzenoid aromatic compound | (iii) | Isobutane |
| d) | Non-benzenoid aromatic compound | (iv) | Furan |
| e) | Heterocyclic compound | (v) | Cyclohexene |
a) Aliphatic compound is \(\textbf{Isobutane (iii)}\).
b) Alicyclic compound is \(\textbf{Cyclohexene (v)}\).
c) Benzenoid aromatic compound is \(\textbf{Phenol (i)}.\)
d) Non-benzenoid aromatic compound is \(\textbf{Tropolone (ii)}\).
e) Heterocyclic compound is \(\textbf{Furan (iv)}\).
The correct option is (B) : a)-(iii); b)-(v); c)-(i); d)-(ii); e)-(iv)
Let's match the compounds with their correct descriptions:
Thus, the correct matching is: a)-(iii); b)-(v); c)-(i); d)-(ii); e)-(iv).
Which are the non-benzenoid aromatic compounds in the following?

What is the major product in the following reaction?
CH3-CH2-CH2-CH=CH2+HBr\(\to\)