List of top Chemistry Questions

Choose the correct order of density of the alkali metals :

The interhalogen compound formed from the reaction of bromine with excess of fluorine is a :

The photochemical smog does not generally contain :

Refining using liquation method is the most suitable for metals with :

Which of the following can be used to prevent the decomposition of $H _2 O _2$ ?

Reaction of \(BeCl _2\) with \(LiAlH _4\) gives: Choose the correct answer from options given below : 

1. \(AlCl _3\)
2. \(BeH _2\)
3. \(LiH\)
4. \(LiCl\)
5. \(BeAlH _4\)
    

Which of the given reactions is not an example of disproportionation reaction?

The dark purple colour of $KMnO _4$ disappears in the titration with oxalic acid in acidic medium. The overall change in the oxidation number of manganese in the reaction is :

$\dot{ C } l + CH _4 \rightarrow A + B$. $A$ and $B$ in the above atmospheric reaction step are

Which technique among the following, is most appropriate in separation of a mixture of $100\, mg$ of $p$-nitrophenol and picric acid ?

The difference in the reaction of phenol with bromine in chloroform and bromine in water medium is due to :

The correct stability order of the following diazonium salt is

Which of the reaction is suitable for concentrating ore by leaching process?

The metal salts formed during softening of hardwater using Clark's method are :

Match List-I with List-II

Identify the incorrect statement from the following

Which of the following relation is not correct?

Statements about Enzyme Inhibitor Drugs are given below:

1. There are Competitive and Noncompetitive inhibitor drugs
2.  These can bind at the active sites and allosteric sites
3.  Competitive Drugs are allosteric site blocking drugs
4.  Non-competitive Drugs are active site blocking drugs 

Choose the correct answer from the options given below :

Terylene polymer is obtained by condensation of :

Choose the correct option for the following reactions

Identify the correct statement for the below given transformation

Match List-I with List-II
 

List-I		List-II
(A)	Cd(s)+2Ni(OH)3(s)→CdO(s)+2Ni(OH)2(s)+H2O(l)	(I)	Primary battery
(B)	Zn(Hg)+HgO(s)→ZnO(s)+Hg(l)	(II)	Discharging of secondary battery
(C)	2PbSO4(s)+2H2O(l)→Pb(s)+PbO2(s)+2H2SO4(aq)	(III)	Fuel cell
(D)	2H2(g)+O2(g)→2H2O(l)	(IV)	Charging of secondary battery

Choose the correct answer from the options given below:

Which reactant will give the following alcohol on reaction with one mole of phenyl magnesium bromide \(( PhMgBr )\) followed by acidic hydrolysis?

Which of the following statement is incorrect?

Which of the following has least tendency toliberate $H_2$ from mineral acids?